C15H17FN2O3 — CID 62023141
3-[3-(4-fluorophenyl)-3-oxopropyl]-5-propylimidazolidine-2,4-dione (PubChem CID 62023141) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-3-oxopropyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-fluorophenyl)-3-oxopropyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62023141 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-3-oxopropyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(CCC(=O)c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H17FN2O3/c1-2-3-12-14(20)18(15(21)17-12)9-8-13(19)10-4-6-11(16)7-5-10/h4-7,12H,2-3,8-9H2,1H3,(H,17,21) |
| InChIKey | RQBTUBHOSDWMIF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|