C13H17N5O2 — CID 167776744
N-methyl-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide (PubChem CID 167776744) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-methyl-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide.
| Compound Name | N-methyl-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167776744 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-methyl-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
| SMILES | CN(Cc1n[nH]c(=O)[nH]1)C(=O)c1cc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C13H17N5O2/c1-18(7-11-15-13(20)17-16-11)12(19)10-6-8-4-2-3-5-9(8)14-10/h6,14H,2-5,7H2,1H3,(H2,15,16,17,20) |
| InChIKey | WKHWVUKHMRAQHZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |