C22H27BrN4O2 — CID 167777314
8-bromo-N-[1-[(E)-2,3-dimethylpent-2-enoyl]-4-methylpiperidin-3-yl]-1,6-naphthyridine-2-carboxamide (PubChem CID 167777314) has the molecular formula C22H27BrN4O2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 8-bromo-N-[1-[(E)-2,3-dimethylpent-2-enoyl]-4-methylpiperidin-3-yl]-1,6-naphthyridine-2-carboxamide.
| Compound Name | 8-bromo-N-[1-[(E)-2,3-dimethylpent-2-enoyl]-4-methylpiperidin-3-yl]-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 167777314 |
| Molecular Formula | C22H27BrN4O2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 8-bromo-N-[1-[(E)-2,3-dimethylpent-2-enoyl]-4-methylpiperidin-3-yl]-1,6-naphthyridine-2-carboxamide |
| SMILES | CC/C(C)=C(\C)C(=O)N1CCC(C)C(NC(=O)c2ccc3cncc(Br)c3n2)C1 |
| InChI | InChI=1S/C22H27BrN4O2/c1-5-13(2)15(4)22(29)27-9-8-14(3)19(12-27)26-21(28)18-7-6-16-10-24-11-17(23)20(16)25-18/h6-7,10-11,14,19H,5,8-9,12H2,1-4H3,(H,26,28)/b15-13+ |
| InChIKey | LORYZJKGHOBSMQ-FYWRMAATSA-N |
| XLogP | 4.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|