C19H29N3O4S — CID 167778231
N-benzyl-N-(1-cyclobutyl-2-hydroxyethyl)-1-sulfamoylpiperidine-4-carboxamide (PubChem CID 167778231) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-benzyl-N-(1-cyclobutyl-2-hydroxyethyl)-1-sulfamoylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-N-(1-cyclobutyl-2-hydroxyethyl)-1-sulfamoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 167778231 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-benzyl-N-(1-cyclobutyl-2-hydroxyethyl)-1-sulfamoylpiperidine-4-carboxamide |
| SMILES | NS(=O)(=O)N1CCC(C(=O)N(Cc2ccccc2)C(CO)C2CCC2)CC1 |
| InChI | InChI=1S/C19H29N3O4S/c20-27(25,26)21-11-9-17(10-12-21)19(24)22(13-15-5-2-1-3-6-15)18(14-23)16-7-4-8-16/h1-3,5-6,16-18,23H,4,7-14H2,(H2,20,25,26) |
| InChIKey | KTHNEEPXAJBTLB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |