C17H29N7O — CID 167778946
2-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1,3,5-triazin-2-yl]morpholin-2-yl]-N,N-dimethylethanamine (PubChem CID 167778946) has the molecular formula C17H29N7O and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1,3,5-triazin-2-yl]morpholin-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1,3,5-triazin-2-yl]morpholin-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 167778946 |
| Molecular Formula | C17H29N7O |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 2-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-1,3,5-triazin-2-yl]morpholin-2-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1CN(c2ncnc(N3C[C@H]4CNC[C@H]4C3)n2)CCO1 |
| InChI | InChI=1S/C17H29N7O/c1-22(2)4-3-15-11-23(5-6-25-15)16-19-12-20-17(21-16)24-9-13-7-18-8-14(13)10-24/h12-15,18H,3-11H2,1-2H3/t13-,14+,15? |
| InChIKey | FTTPEIIITAEROJ-YIONKMFJSA-N |
| XLogP | -0.32 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |