C17H25IN6O — CID 167780207
6-iodo-N-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 167780207) has the molecular formula C17H25IN6O and a molecular weight of 456.33 g/mol. Its IUPAC name is 6-iodo-N-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-iodo-N-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167780207 |
| Molecular Formula | C17H25IN6O |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 6-iodo-N-[1-(2-morpholin-4-ylethyl)piperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Ic1cc2c(NC3CCCN(CCN4CCOCC4)C3)ncnc2[nH]1 |
| InChI | InChI=1S/C17H25IN6O/c18-15-10-14-16(19-12-20-17(14)22-15)21-13-2-1-3-24(11-13)5-4-23-6-8-25-9-7-23/h10,12-13H,1-9,11H2,(H2,19,20,21,22) |
| InChIKey | HURCDXJCACNPQK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|