C20H26N4O3 — CID 167780383
N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 167780383) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 167780383 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylcarbamoyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)C2CCC(NC(=O)c3cc(C)oc3C)C2)N=N1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-5-8-20(23-24-20)9-10-21-18(25)15-6-7-16(12-15)22-19(26)17-11-13(2)27-14(17)3/h1,11,15-16H,5-10,12H2,2-3H3,(H,21,25)(H,22,26) |
| InChIKey | RGMDALHJTFBCNM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|