C15H19N5O2 — CID 166429657
(2S,5R)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(1H-pyrazol-5-yl)oxolane-2-carboxamide (PubChem CID 166429657) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S,5R)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(1H-pyrazol-5-yl)oxolane-2-carboxamide.
| Compound Name | (2S,5R)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(1H-pyrazol-5-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 166429657 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S,5R)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(1H-pyrazol-5-yl)oxolane-2-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)[C@@H]2CC[C@H](c3ccn[nH]3)O2)N=N1 |
| InChI | InChI=1S/C15H19N5O2/c1-2-3-7-15(19-20-15)8-10-16-14(21)13-5-4-12(22-13)11-6-9-17-18-11/h1,6,9,12-13H,3-5,7-8,10H2,(H,16,21)(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | ACPODCZDNHGOLA-OLZOCXBDSA-N |
| XLogP | 1.71 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|