C18H13F2N5O3S2 — CID 167780537
1-[4-(difluoromethyl)-1,3-thiazol-2-yl]-3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]methyl]urea (PubChem CID 167780537) has the molecular formula C18H13F2N5O3S2 and a molecular weight of 449.46 g/mol. Its IUPAC name is 1-[4-(difluoromethyl)-1,3-thiazol-2-yl]-3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]methyl]urea.
| Compound Name | 1-[4-(difluoromethyl)-1,3-thiazol-2-yl]-3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 167780537 |
| Molecular Formula | C18H13F2N5O3S2 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 1-[4-(difluoromethyl)-1,3-thiazol-2-yl]-3-[[4-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]methyl]urea |
| SMILES | O=C(NCc1nc(CN2C(=O)c3ccccc3C2=O)cs1)Nc1nc(C(F)F)cs1 |
| InChI | InChI=1S/C18H13F2N5O3S2/c19-14(20)12-8-30-18(23-12)24-17(28)21-5-13-22-9(7-29-13)6-25-15(26)10-3-1-2-4-11(10)16(25)27/h1-4,7-8,14H,5-6H2,(H2,21,23,24,28) |
| InChIKey | OZJLQQAJBREXOY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|