C22H26N4O2S — CID 167782243
3-(1-acetylpiperidin-4-yl)-1-(1H-indol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 167782243) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-(1-acetylpiperidin-4-yl)-1-(1H-indol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-(1-acetylpiperidin-4-yl)-1-(1H-indol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 167782243 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(1-acetylpiperidin-4-yl)-1-(1H-indol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | CC(=O)N1CCC(NC(=O)N(Cc2ccc3[nH]ccc3c2)Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-16(27)25-10-7-19(8-11-25)24-22(28)26(15-20-3-2-12-29-20)14-17-4-5-21-18(13-17)6-9-23-21/h2-6,9,12-13,19,23H,7-8,10-11,14-15H2,1H3,(H,24,28) |
| InChIKey | OQGOMXWPYXDPNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |