C14H24F3N3O2 — CID 167784422
2-(4-aminocyclohexyl)oxy-1-[5-amino-2-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 167784422) has the molecular formula C14H24F3N3O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-(4-aminocyclohexyl)oxy-1-[5-amino-2-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-aminocyclohexyl)oxy-1-[5-amino-2-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 167784422 |
| Molecular Formula | C14H24F3N3O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-(4-aminocyclohexyl)oxy-1-[5-amino-2-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | NC1CCC(OCC(=O)N2CC(N)CCC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H24F3N3O2/c15-14(16,17)12-6-3-10(19)7-20(12)13(21)8-22-11-4-1-9(18)2-5-11/h9-12H,1-8,18-19H2 |
| InChIKey | QJJIBRVDJKKYPW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |