C15H25N3O3 — CID 167833071
6-[2-(4-aminocyclohexyl)oxyacetyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one (PubChem CID 167833071) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6-[2-(4-aminocyclohexyl)oxyacetyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one.
| Compound Name | 6-[2-(4-aminocyclohexyl)oxyacetyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 167833071 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 6-[2-(4-aminocyclohexyl)oxyacetyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one |
| SMILES | NC1CCC(OCC(=O)N2CC3CCC(=O)NC3C2)CC1 |
| InChI | InChI=1S/C15H25N3O3/c16-11-2-4-12(5-3-11)21-9-15(20)18-7-10-1-6-14(19)17-13(10)8-18/h10-13H,1-9,16H2,(H,17,19) |
| InChIKey | GDPDADWVVKZXNM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |