C13H14F2N2O2S — CID 166296261
6-[4-(difluoromethyl)thiophene-2-carbonyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one (PubChem CID 166296261) has the molecular formula C13H14F2N2O2S and a molecular weight of 300.33 g/mol. Its IUPAC name is 6-[4-(difluoromethyl)thiophene-2-carbonyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one.
| Compound Name | 6-[4-(difluoromethyl)thiophene-2-carbonyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 166296261 |
| Molecular Formula | C13H14F2N2O2S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-[4-(difluoromethyl)thiophene-2-carbonyl]-3,4,4a,5,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-one |
| SMILES | O=C1CCC2CN(C(=O)c3cc(C(F)F)cs3)CC2N1 |
| InChI | InChI=1S/C13H14F2N2O2S/c14-12(15)8-3-10(20-6-8)13(19)17-4-7-1-2-11(18)16-9(7)5-17/h3,6-7,9,12H,1-2,4-5H2,(H,16,18) |
| InChIKey | VALQEDBYIDOXSQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |