C20H20ClN5OS — CID 167785418
N-(5-chloro-2-pyridinyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidine-4-carboxamide (PubChem CID 167785418) has the molecular formula C20H20ClN5OS and a molecular weight of 413.93 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167785418 |
| Molecular Formula | C20H20ClN5OS |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidine-4-carboxamide |
| SMILES | CSc1ccc2ncnc(N3CCC(C(=O)Nc4ccc(Cl)cn4)CC3)c2c1 |
| InChI | InChI=1S/C20H20ClN5OS/c1-28-15-3-4-17-16(10-15)19(24-12-23-17)26-8-6-13(7-9-26)20(27)25-18-5-2-14(21)11-22-18/h2-5,10-13H,6-9H2,1H3,(H,22,25,27) |
| InChIKey | SDDTURJDJJYICW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |