C20H20ClN3OS — CID 167921455
4-(4-chlorophenyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol (PubChem CID 167921455) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 167921455 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol |
| SMILES | CSc1ccc2ncnc(N3CCC(O)(c4ccc(Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C20H20ClN3OS/c1-26-16-6-7-18-17(12-16)19(23-13-22-18)24-10-8-20(25,9-11-24)14-2-4-15(21)5-3-14/h2-7,12-13,25H,8-11H2,1H3 |
| InChIKey | AETZTPUZMFXOKG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |