C20H27N3OS — CID 167836092
4-cyclohexyl-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol (PubChem CID 167836092) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-cyclohexyl-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol.
| Compound Name | 4-cyclohexyl-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 167836092 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-cyclohexyl-1-(6-methylsulfanylquinazolin-4-yl)piperidin-4-ol |
| SMILES | CSc1ccc2ncnc(N3CCC(O)(C4CCCCC4)CC3)c2c1 |
| InChI | InChI=1S/C20H27N3OS/c1-25-16-7-8-18-17(13-16)19(22-14-21-18)23-11-9-20(24,10-12-23)15-5-3-2-4-6-15/h7-8,13-15,24H,2-6,9-12H2,1H3 |
| InChIKey | YDBRCGMOOGYORI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |