C21H22FN3OS — CID 167908748
4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-6-methylsulfanylquinazoline (PubChem CID 167908748) has the molecular formula C21H22FN3OS and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-6-methylsulfanylquinazoline.
| Compound Name | 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-6-methylsulfanylquinazoline |
|---|---|
| PubChem CID | 167908748 |
| Molecular Formula | C21H22FN3OS |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-6-methylsulfanylquinazoline |
| SMILES | CSc1ccc2ncnc(N3CCC(OCc4ccc(F)cc4)CC3)c2c1 |
| InChI | InChI=1S/C21H22FN3OS/c1-27-18-6-7-20-19(12-18)21(24-14-23-20)25-10-8-17(9-11-25)26-13-15-2-4-16(22)5-3-15/h2-7,12,14,17H,8-11,13H2,1H3 |
| InChIKey | ZBKAQZAGZVSEHC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |