C17H19N3OS — CID 167874906
2-(6-methylsulfanylquinazolin-4-yl)-6-oxa-2-azaspiro[4.5]dec-8-ene (PubChem CID 167874906) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-(6-methylsulfanylquinazolin-4-yl)-6-oxa-2-azaspiro[4.5]dec-8-ene.
| Compound Name | 2-(6-methylsulfanylquinazolin-4-yl)-6-oxa-2-azaspiro[4.5]dec-8-ene |
|---|---|
| PubChem CID | 167874906 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(6-methylsulfanylquinazolin-4-yl)-6-oxa-2-azaspiro[4.5]dec-8-ene |
| SMILES | CSc1ccc2ncnc(N3CCC4(CC=CCO4)C3)c2c1 |
| InChI | InChI=1S/C17H19N3OS/c1-22-13-4-5-15-14(10-13)16(19-12-18-15)20-8-7-17(11-20)6-2-3-9-21-17/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | SBGTZJCIIFQMPR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|