C17H21N3OS — CID 167748744
9-(6-methylsulfanylquinazolin-4-yl)-1-oxa-9-azaspiro[4.5]decane (PubChem CID 167748744) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 9-(6-methylsulfanylquinazolin-4-yl)-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | 9-(6-methylsulfanylquinazolin-4-yl)-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 167748744 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 9-(6-methylsulfanylquinazolin-4-yl)-1-oxa-9-azaspiro[4.5]decane |
| SMILES | CSc1ccc2ncnc(N3CCCC4(CCCO4)C3)c2c1 |
| InChI | InChI=1S/C17H21N3OS/c1-22-13-4-5-15-14(10-13)16(19-12-18-15)20-8-2-6-17(11-20)7-3-9-21-17/h4-5,10,12H,2-3,6-9,11H2,1H3 |
| InChIKey | QXBFBDAYQDLBSV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |