C17H18N2O4S — CID 167788277
2-hydroxy-5-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 167788277) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-hydroxy-5-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2-hydroxy-5-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167788277 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-hydroxy-5-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2cccc(N3CCCCC3=O)c2)ccc1O |
| InChI | InChI=1S/C17H18N2O4S/c18-24(22,23)16-11-13(7-8-15(16)20)12-4-3-5-14(10-12)19-9-2-1-6-17(19)21/h3-5,7-8,10-11,20H,1-2,6,9H2,(H2,18,22,23) |
| InChIKey | OUQJKXFRSFTJLQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |