C10H11BrN2O3S — CID 55257523
2-bromo-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 55257523) has the molecular formula C10H11BrN2O3S and a molecular weight of 319.18 g/mol. Its IUPAC name is 2-bromo-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | 2-bromo-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 55257523 |
| Molecular Formula | C10H11BrN2O3S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 2-bromo-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCCC2=O)cc1Br |
| InChI | InChI=1S/C10H11BrN2O3S/c11-8-6-7(13-5-1-2-10(13)14)3-4-9(8)17(12,15)16/h3-4,6H,1-2,5H2,(H2,12,15,16) |
| InChIKey | DJXGXKDRZGCGSJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |