C16H17N5O2S — CID 167789932
6-[2-(5-phenylimidazol-1-yl)ethylamino]pyridine-3-sulfonamide (PubChem CID 167789932) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 6-[2-(5-phenylimidazol-1-yl)ethylamino]pyridine-3-sulfonamide.
| Compound Name | 6-[2-(5-phenylimidazol-1-yl)ethylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 167789932 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 6-[2-(5-phenylimidazol-1-yl)ethylamino]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCn2cncc2-c2ccccc2)nc1 |
| InChI | InChI=1S/C16H17N5O2S/c17-24(22,23)14-6-7-16(20-10-14)19-8-9-21-12-18-11-15(21)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2,(H,19,20)(H2,17,22,23) |
| InChIKey | ZYCZMTHVDBDYSG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |