C22H23N5O2 — CID 167793693
1-benzoyl-N-[phenyl(1H-1,2,4-triazol-5-yl)methyl]piperidine-4-carboxamide (PubChem CID 167793693) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-benzoyl-N-[phenyl(1H-1,2,4-triazol-5-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[phenyl(1H-1,2,4-triazol-5-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 167793693 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-benzoyl-N-[phenyl(1H-1,2,4-triazol-5-yl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ncn[nH]1)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N5O2/c28-21(25-19(20-23-15-24-26-20)16-7-3-1-4-8-16)17-11-13-27(14-12-17)22(29)18-9-5-2-6-10-18/h1-10,15,17,19H,11-14H2,(H,25,28)(H,23,24,26) |
| InChIKey | GPFJOVUBMCSUPW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |