C17H16ClN3O4 — CID 167794774
5-(4-chlorophenyl)-N-[(3-hydroxy-1-prop-2-enoylazetidin-3-yl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 167794774) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(3-hydroxy-1-prop-2-enoylazetidin-3-yl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(3-hydroxy-1-prop-2-enoylazetidin-3-yl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 167794774 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(3-hydroxy-1-prop-2-enoylazetidin-3-yl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | C=CC(=O)N1CC(O)(CNC(=O)c2cc(-c3ccc(Cl)cc3)on2)C1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-2-15(22)21-9-17(24,10-21)8-19-16(23)13-7-14(25-20-13)11-3-5-12(18)6-4-11/h2-7,24H,1,8-10H2,(H,19,23) |
| InChIKey | ILUMDPVONFZEBZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|