C15H15F3N4O2S — CID 167794775
N'-[1-(1,3-thiazol-4-yl)ethyl]-N-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide (PubChem CID 167794775) has the molecular formula C15H15F3N4O2S and a molecular weight of 372.37 g/mol. Its IUPAC name is N'-[1-(1,3-thiazol-4-yl)ethyl]-N-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide.
| Compound Name | N'-[1-(1,3-thiazol-4-yl)ethyl]-N-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide |
|---|---|
| PubChem CID | 167794775 |
| Molecular Formula | C15H15F3N4O2S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N'-[1-(1,3-thiazol-4-yl)ethyl]-N-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)N[C@@H](C)c1ccc(C(F)(F)F)nc1)c1cscn1 |
| InChI | InChI=1S/C15H15F3N4O2S/c1-8(10-3-4-12(19-5-10)15(16,17)18)21-13(23)14(24)22-9(2)11-6-25-7-20-11/h3-9H,1-2H3,(H,21,23)(H,22,24)/t8-,9?/m0/s1 |
| InChIKey | IIAXSVJEDQFZFH-IENPIDJESA-N |
| XLogP | 2.61 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|