C14H13ClF3N3O4S — CID 167796401
ethyl 2-chloro-5-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]sulfamoyl]-4-fluorobenzoate (PubChem CID 167796401) has the molecular formula C14H13ClF3N3O4S and a molecular weight of 411.79 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]sulfamoyl]-4-fluorobenzoate.
| Compound Name | ethyl 2-chloro-5-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]sulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 167796401 |
| Molecular Formula | C14H13ClF3N3O4S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | ethyl 2-chloro-5-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]sulfamoyl]-4-fluorobenzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2cn(C)nc2C(F)F)c(F)cc1Cl |
| InChI | InChI=1S/C14H13ClF3N3O4S/c1-3-25-14(22)7-4-11(9(16)5-8(7)15)26(23,24)20-10-6-21(2)19-12(10)13(17)18/h4-6,13,20H,3H2,1-2H3 |
| InChIKey | MRIKJZARHPHTHM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |