C18H24N2O3 — CID 167798565
1-[4-[4-[(1S)-1-hydroxyethyl]benzoyl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167798565) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[4-[4-[(1S)-1-hydroxyethyl]benzoyl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[(1S)-1-hydroxyethyl]benzoyl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167798565 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[4-[4-[(1S)-1-hydroxyethyl]benzoyl]-2,2-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)c2ccc([C@H](C)O)cc2)CC1(C)C |
| InChI | InChI=1S/C18H24N2O3/c1-5-16(22)20-11-10-19(12-18(20,3)4)17(23)15-8-6-14(7-9-15)13(2)21/h5-9,13,21H,1,10-12H2,2-4H3/t13-/m0/s1 |
| InChIKey | TWZUGEJJZHSFAT-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|