C18H19F2N5O2 — CID 167800340
N-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-N'-(1-ethyl-4-methylpyrazol-5-yl)oxamide (PubChem CID 167800340) has the molecular formula C18H19F2N5O2 and a molecular weight of 375.38 g/mol. Its IUPAC name is N-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-N'-(1-ethyl-4-methylpyrazol-5-yl)oxamide.
| Compound Name | N-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-N'-(1-ethyl-4-methylpyrazol-5-yl)oxamide |
|---|---|
| PubChem CID | 167800340 |
| Molecular Formula | C18H19F2N5O2 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-N'-(1-ethyl-4-methylpyrazol-5-yl)oxamide |
| SMILES | CCn1ncc(C)c1NC(=O)C(=O)NCCc1c[nH]c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C18H19F2N5O2/c1-3-25-16(10(2)8-23-25)24-18(27)17(26)21-5-4-11-9-22-14-7-12(19)6-13(20)15(11)14/h6-9,22H,3-5H2,1-2H3,(H,21,26)(H,24,27) |
| InChIKey | TUFCSINMKLXIKB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|