C15H18F2N2O — CID 169001103
1-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol (PubChem CID 169001103) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol.
| Compound Name | 1-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 169001103 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-[2-(4,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(CCc2c[nH]c3cc(F)cc(F)c23)C1 |
| InChI | InChI=1S/C15H18F2N2O/c1-15(20)3-5-19(9-15)4-2-10-8-18-13-7-11(16)6-12(17)14(10)13/h6-8,18,20H,2-5,9H2,1H3 |
| InChIKey | CMTWSHNEXZDLBQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |