About (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol
(E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol (PubChem CID 175922591) has the molecular formula C19H22F2N2O5
and a molecular weight of 396.39 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol |
| PubChem CID | 175922591 |
| Molecular Formula | C19H22F2N2O5 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(CCc2c[nH]c3cc(F)c(F)cc23)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H18F2N2O.C4H4O4/c1-15(20)3-5-19(9-15)4-2-10-8-18-14-7-13(17)12(16)6-11(10)14;5-3(6)1-2-4(7)8/h6-8,18,20H,2-5,9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IZJALPVVFBQBHI-WLHGVMLRSA-N |
| XLogP | 2.16 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol?
The IUPAC name of (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol (CID 175922591) is (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol.
What is the SMILES notation for (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol?
The canonical SMILES for (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol is CC1(O)CCN(CCc2c[nH]c3cc(F)c(F)cc23)C1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol?
The InChIKey is IZJALPVVFBQBHI-WLHGVMLRSA-N. The full InChI is InChI=1S/C15H18F2N2O.C4H4O4/c1-15(20)3-5-19(9-15)4-2-10-8-18-14-7-13(17)12(16)6-11(10)14;5-3(6)1-2-4(7)8/h6-8,18,20H,2-5,9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol?
(E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol has a molecular weight of 396.39 g/mol, XLogP of 2.16, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;1-[2-(5,6-difluoro-1H-indol-3-yl)ethyl]-3-methylpyrrolidin-3-ol is sourced from PubChem (CID 175922591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).