C15H13N5O4 — CID 167804334
N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-5-methyl-4-nitro-1H-pyrazole-3-carboxamide (PubChem CID 167804334) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-5-methyl-4-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167804334 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-5-methyl-4-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)Nc2ccc3oc(C4CC4)nc3c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N5O4/c1-7-13(20(22)23)12(19-18-7)14(21)16-9-4-5-11-10(6-9)17-15(24-11)8-2-3-8/h4-6,8H,2-3H2,1H3,(H,16,21)(H,18,19) |
| InChIKey | YSTRRZNNWCCSBE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|