C14H13N3O4 — CID 51117633
N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-2-nitrocyclopropane-1-carboxamide (PubChem CID 51117633) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-2-nitrocyclopropane-1-carboxamide.
| Compound Name | N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 51117633 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(2-cyclopropyl-1,3-benzoxazol-5-yl)-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc2oc(C3CC3)nc2c1)C1CC1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13N3O4/c18-13(9-6-11(9)17(19)20)15-8-3-4-12-10(5-8)16-14(21-12)7-1-2-7/h3-5,7,9,11H,1-2,6H2,(H,15,18) |
| InChIKey | PDRMXHVZIMSDIM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|