C19H21ClN4 — CID 167804420
1-[(2-chlorophenyl)methyl]-4-[[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methyl]pyrazole (PubChem CID 167804420) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-4-[[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methyl]pyrazole.
| Compound Name | 1-[(2-chlorophenyl)methyl]-4-[[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 167804420 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-4-[[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methyl]pyrazole |
| SMILES | Clc1ccccc1Cn1cc(CN2CCCC2c2ccc[nH]2)cn1 |
| InChI | InChI=1S/C19H21ClN4/c20-17-6-2-1-5-16(17)14-24-13-15(11-22-24)12-23-10-4-8-19(23)18-7-3-9-21-18/h1-3,5-7,9,11,13,19,21H,4,8,10,12,14H2 |
| InChIKey | SSEMLODBWDNPTB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |