C18H28N2O4 — CID 167806025
3-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethylamino]propanamide (PubChem CID 167806025) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethylamino]propanamide.
| Compound Name | 3-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethylamino]propanamide |
|---|---|
| PubChem CID | 167806025 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethylamino]propanamide |
| SMILES | COc1cc(CCNCCC(N)=O)cc(OC)c1OCC1CCC1 |
| InChI | InChI=1S/C18H28N2O4/c1-22-15-10-14(6-8-20-9-7-17(19)21)11-16(23-2)18(15)24-12-13-4-3-5-13/h10-11,13,20H,3-9,12H2,1-2H3,(H2,19,21) |
| InChIKey | FPESCXFYSLPWMD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|