C19H28N2O4 — CID 166301536
1-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethyl]-3-prop-2-enylurea (PubChem CID 166301536) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethyl]-3-prop-2-enylurea.
| Compound Name | 1-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 166301536 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[2-[4-(cyclobutylmethoxy)-3,5-dimethoxyphenyl]ethyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NCCc1cc(OC)c(OCC2CCC2)c(OC)c1 |
| InChI | InChI=1S/C19H28N2O4/c1-4-9-20-19(22)21-10-8-15-11-16(23-2)18(17(12-15)24-3)25-13-14-6-5-7-14/h4,11-12,14H,1,5-10,13H2,2-3H3,(H2,20,21,22) |
| InChIKey | JPFGUKKPZVKSLI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|