C15H15N3O5 — CID 167809125
3-methoxy-N-(6-nitroisoquinolin-1-yl)oxolane-3-carboxamide (PubChem CID 167809125) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 3-methoxy-N-(6-nitroisoquinolin-1-yl)oxolane-3-carboxamide.
| Compound Name | 3-methoxy-N-(6-nitroisoquinolin-1-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 167809125 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-methoxy-N-(6-nitroisoquinolin-1-yl)oxolane-3-carboxamide |
| SMILES | COC1(C(=O)Nc2nccc3cc([N+](=O)[O-])ccc23)CCOC1 |
| InChI | InChI=1S/C15H15N3O5/c1-22-15(5-7-23-9-15)14(19)17-13-12-3-2-11(18(20)21)8-10(12)4-6-16-13/h2-4,6,8H,5,7,9H2,1H3,(H,16,17,19) |
| InChIKey | GLHSHLZANWPEHP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|