C18H37NO3Si — CID 167809144
[3-[[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentylethyl]amino]methyl]oxetan-3-yl]methanol (PubChem CID 167809144) has the molecular formula C18H37NO3Si and a molecular weight of 343.58 g/mol. Its IUPAC name is [3-[[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentylethyl]amino]methyl]oxetan-3-yl]methanol.
| Compound Name | [3-[[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentylethyl]amino]methyl]oxetan-3-yl]methanol |
|---|---|
| PubChem CID | 167809144 |
| Molecular Formula | C18H37NO3Si |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | [3-[[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclopentylethyl]amino]methyl]oxetan-3-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC(CNCC1(CO)COC1)C1CCCC1 |
| InChI | InChI=1S/C18H37NO3Si/c1-17(2,3)23(4,5)22-16(15-8-6-7-9-15)10-19-11-18(12-20)13-21-14-18/h15-16,19-20H,6-14H2,1-5H3 |
| InChIKey | ACJBFRDYUCZSKX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|