C37H75NO5Si — CID 176613721
1,3-dihexoxypropan-2-yl 8-[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]amino]octanoate (PubChem CID 176613721) has the molecular formula C37H75NO5Si and a molecular weight of 642.10 g/mol. Its IUPAC name is 1,3-dihexoxypropan-2-yl 8-[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]amino]octanoate.
| Compound Name | 1,3-dihexoxypropan-2-yl 8-[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]amino]octanoate |
|---|---|
| PubChem CID | 176613721 |
| Molecular Formula | C37H75NO5Si |
| Molecular Weight | 642.10 g/mol |
| Exact Mass | 641.54 |
| IUPAC Name | 1,3-dihexoxypropan-2-yl 8-[[2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylethyl]amino]octanoate |
| SMILES | CCCCCCOCC(COCCCCCC)OC(=O)CCCCCCCNCC(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C37H75NO5Si/c1-8-10-12-22-28-40-31-34(32-41-29-23-13-11-9-2)42-36(39)26-20-15-14-16-21-27-38-30-35(33-24-18-17-19-25-33)43-44(6,7)37(3,4)5/h33-35,38H,8-32H2,1-7H3 |
| InChIKey | XIQRSMCMBZCKJD-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.10 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|