C18H22N6O2 — CID 167809482
N-[3-[[2-(5-amino-2-pyridinyl)acetyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 167809482) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[3-[[2-(5-amino-2-pyridinyl)acetyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-[3-[[2-(5-amino-2-pyridinyl)acetyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 167809482 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[3-[[2-(5-amino-2-pyridinyl)acetyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | Nc1ccc(CC(=O)Nc2cccc(NC(=O)N3CCNCC3)c2)nc1 |
| InChI | InChI=1S/C18H22N6O2/c19-13-4-5-14(21-12-13)11-17(25)22-15-2-1-3-16(10-15)23-18(26)24-8-6-20-7-9-24/h1-5,10,12,20H,6-9,11,19H2,(H,22,25)(H,23,26) |
| InChIKey | BNZALHQMIFHMNV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |