C20H26N4 — CID 167810243
N-(1-benzylpiperidin-4-yl)-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 167810243) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 167810243 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | c1ccc(CN2CCC(Nc3ncc4c(n3)CCCC4)CC2)cc1 |
| InChI | InChI=1S/C20H26N4/c1-2-6-16(7-3-1)15-24-12-10-18(11-13-24)22-20-21-14-17-8-4-5-9-19(17)23-20/h1-3,6-7,14,18H,4-5,8-13,15H2,(H,21,22,23) |
| InChIKey | QZFXEEJVCQJXNC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |