C31H29ClF7N5O4 — CID 167810815
N-[2-(4-chlorophenyl)-2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]-N'-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]oxamide;2,2,2-trifluoroacetic acid (PubChem CID 167810815) has the molecular formula C31H29ClF7N5O4 and a molecular weight of 704.04 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]-N'-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]oxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(4-chlorophenyl)-2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]-N'-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]oxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167810815 |
| Molecular Formula | C31H29ClF7N5O4 |
| Molecular Weight | 704.04 g/mol |
| Exact Mass | 703.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]-N'-[4-(5-fluoro-1-methylbenzimidazol-2-yl)-2-methylphenyl]oxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(-c2nc3cc(F)ccc3n2C)ccc1NC(=O)C(=O)NCC(c1ccc(Cl)cc1)N(C)CCC(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H28ClF4N5O2.C2HF3O2/c1-17-14-19(26-36-23-15-21(31)9-11-24(23)39(26)3)6-10-22(17)37-28(41)27(40)35-16-25(18-4-7-20(30)8-5-18)38(2)13-12-29(32,33)34;3-2(4,5)1(6)7/h4-11,14-15,25H,12-13,16H2,1-3H3,(H,35,40)(H,37,41);(H,6,7) |
| InChIKey | QZMWOMPALFCHSA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.04 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|