C18H22F2N4O — CID 167810830
(3R,8aS)-3-[2-(3,5-difluorophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine (PubChem CID 167810830) has the molecular formula C18H22F2N4O and a molecular weight of 348.40 g/mol. Its IUPAC name is (3R,8aS)-3-[2-(3,5-difluorophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
| Compound Name | (3R,8aS)-3-[2-(3,5-difluorophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 167810830 |
| Molecular Formula | C18H22F2N4O |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3R,8aS)-3-[2-(3,5-difluorophenyl)-5-propan-2-yl-1,2,4-triazol-3-yl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
| SMILES | CC(C)c1nc([C@H]2CN3CCC[C@H]3CO2)n(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C18H22F2N4O/c1-11(2)17-21-18(16-9-23-5-3-4-14(23)10-25-16)24(22-17)15-7-12(19)6-13(20)8-15/h6-8,11,14,16H,3-5,9-10H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | IASAZRXHHAQXNL-GOEBONIOSA-N |
| XLogP | 3.20 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |