C18H28N6O4 — CID 167812139
1-methyl-3-[[4-[2-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxoacetyl]morpholin-2-yl]methyl]urea (PubChem CID 167812139) has the molecular formula C18H28N6O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-methyl-3-[[4-[2-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxoacetyl]morpholin-2-yl]methyl]urea.
| Compound Name | 1-methyl-3-[[4-[2-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxoacetyl]morpholin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 167812139 |
| Molecular Formula | C18H28N6O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-methyl-3-[[4-[2-[4-(1-methylpyrazol-4-yl)piperidin-1-yl]-2-oxoacetyl]morpholin-2-yl]methyl]urea |
| SMILES | CNC(=O)NCC1CN(C(=O)C(=O)N2CCC(c3cnn(C)c3)CC2)CCO1 |
| InChI | InChI=1S/C18H28N6O4/c1-19-18(27)20-10-15-12-24(7-8-28-15)17(26)16(25)23-5-3-13(4-6-23)14-9-21-22(2)11-14/h9,11,13,15H,3-8,10,12H2,1-2H3,(H2,19,20,27) |
| InChIKey | SQSSFXVJBQQHKP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|