C18H18FN3O2 — CID 167817476
[5-(2-fluorophenyl)furan-2-yl]-[4-(3-methyldiazirin-3-yl)piperidin-1-yl]methanone (PubChem CID 167817476) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is [5-(2-fluorophenyl)furan-2-yl]-[4-(3-methyldiazirin-3-yl)piperidin-1-yl]methanone.
| Compound Name | [5-(2-fluorophenyl)furan-2-yl]-[4-(3-methyldiazirin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167817476 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [5-(2-fluorophenyl)furan-2-yl]-[4-(3-methyldiazirin-3-yl)piperidin-1-yl]methanone |
| SMILES | CC1(C2CCN(C(=O)c3ccc(-c4ccccc4F)o3)CC2)N=N1 |
| InChI | InChI=1S/C18H18FN3O2/c1-18(20-21-18)12-8-10-22(11-9-12)17(23)16-7-6-15(24-16)13-4-2-3-5-14(13)19/h2-7,12H,8-11H2,1H3 |
| InChIKey | BYAKEKUFPSFYOE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |