C15H16FNO5S — CID 167817757
3-[(3-fluorophenyl)methyl-(4-methylfuran-2-yl)sulfonylamino]propanoic acid (PubChem CID 167817757) has the molecular formula C15H16FNO5S and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl-(4-methylfuran-2-yl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(3-fluorophenyl)methyl-(4-methylfuran-2-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 167817757 |
| Molecular Formula | C15H16FNO5S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl-(4-methylfuran-2-yl)sulfonylamino]propanoic acid |
| SMILES | Cc1coc(S(=O)(=O)N(CCC(=O)O)Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H16FNO5S/c1-11-7-15(22-10-11)23(20,21)17(6-5-14(18)19)9-12-3-2-4-13(16)8-12/h2-4,7-8,10H,5-6,9H2,1H3,(H,18,19) |
| InChIKey | KJMRGEPUUXIQJQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |