C16H23N3O3 — CID 167819458
N-[1-(2-oxabicyclo[2.1.1]hexan-1-yl)ethyl]-2-(4-propoxypyrimidin-2-yl)acetamide (PubChem CID 167819458) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[1-(2-oxabicyclo[2.1.1]hexan-1-yl)ethyl]-2-(4-propoxypyrimidin-2-yl)acetamide.
| Compound Name | N-[1-(2-oxabicyclo[2.1.1]hexan-1-yl)ethyl]-2-(4-propoxypyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 167819458 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[1-(2-oxabicyclo[2.1.1]hexan-1-yl)ethyl]-2-(4-propoxypyrimidin-2-yl)acetamide |
| SMILES | CCCOc1ccnc(CC(=O)NC(C)C23CC(CO2)C3)n1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-6-21-15-4-5-17-13(19-15)7-14(20)18-11(2)16-8-12(9-16)10-22-16/h4-5,11-12H,3,6-10H2,1-2H3,(H,18,20) |
| InChIKey | SPQJXJIULJRGLG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |