C13H16N4O2S — CID 126840670
2-(4-propoxypyrimidin-2-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide (PubChem CID 126840670) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(4-propoxypyrimidin-2-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide.
| Compound Name | 2-(4-propoxypyrimidin-2-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126840670 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(4-propoxypyrimidin-2-yl)-N-(1,3-thiazol-2-ylmethyl)acetamide |
| SMILES | CCCOc1ccnc(CC(=O)NCc2nccs2)n1 |
| InChI | InChI=1S/C13H16N4O2S/c1-2-6-19-12-3-4-14-10(17-12)8-11(18)16-9-13-15-5-7-20-13/h3-5,7H,2,6,8-9H2,1H3,(H,16,18) |
| InChIKey | WIVMZPGIBKNZSH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |