C21H24N6O4 — CID 167821896
4-[3-[1-[(E)-3-(6-oxo-1H-pyrimidin-5-yl)prop-2-enoyl]azepan-3-yl]azetidine-1-carbonyl]-1H-pyrimidin-6-one (PubChem CID 167821896) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-[3-[1-[(E)-3-(6-oxo-1H-pyrimidin-5-yl)prop-2-enoyl]azepan-3-yl]azetidine-1-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[3-[1-[(E)-3-(6-oxo-1H-pyrimidin-5-yl)prop-2-enoyl]azepan-3-yl]azetidine-1-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 167821896 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-[3-[1-[(E)-3-(6-oxo-1H-pyrimidin-5-yl)prop-2-enoyl]azepan-3-yl]azetidine-1-carbonyl]-1H-pyrimidin-6-one |
| SMILES | O=C(/C=C/c1cnc[nH]c1=O)N1CCCCC(C2CN(C(=O)c3cc(=O)[nH]cn3)C2)C1 |
| InChI | InChI=1S/C21H24N6O4/c28-18-7-17(23-13-24-18)21(31)27-10-16(11-27)15-3-1-2-6-26(9-15)19(29)5-4-14-8-22-12-25-20(14)30/h4-5,7-8,12-13,15-16H,1-3,6,9-11H2,(H,22,25,30)(H,23,24,28)/b5-4+ |
| InChIKey | BCFBKDWKKFYYHK-SNAWJCMRSA-N |
| XLogP | 0.27 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|