C15H13F5N2O3S — CID 167823629
N-[1-[3-(difluoromethoxy)phenyl]ethyl]-5-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 167823629) has the molecular formula C15H13F5N2O3S and a molecular weight of 396.34 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]-5-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 167823629 |
| Molecular Formula | C15H13F5N2O3S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-5-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(C(F)(F)F)cn1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H13F5N2O3S/c1-9(10-3-2-4-12(7-10)25-14(16)17)22-26(23,24)13-6-5-11(8-21-13)15(18,19)20/h2-9,14,22H,1H3 |
| InChIKey | FCINYRKWKKMICZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |