About 1-imidazol-1-yl-1,3-diphenylpropan-2-amine
1-imidazol-1-yl-1,3-diphenylpropan-2-amine (PubChem CID 16782420) has the molecular formula C18H19N3
and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-imidazol-1-yl-1,3-diphenylpropan-2-amine.
Molecular Properties
| Compound Name | 1-imidazol-1-yl-1,3-diphenylpropan-2-amine |
| PubChem CID | 16782420 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-imidazol-1-yl-1,3-diphenylpropan-2-amine |
| SMILES | NC(Cc1ccccc1)C(c1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C18H19N3/c19-17(13-15-7-3-1-4-8-15)18(21-12-11-20-14-21)16-9-5-2-6-10-16/h1-12,14,17-18H,13,19H2 |
| InChIKey | FNZASKVUDGTAEV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imidazol-1-yl-1,3-diphenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazol-1-yl-1,3-diphenylpropan-2-amine?
The IUPAC name of 1-imidazol-1-yl-1,3-diphenylpropan-2-amine (CID 16782420) is 1-imidazol-1-yl-1,3-diphenylpropan-2-amine.
What is the SMILES notation for 1-imidazol-1-yl-1,3-diphenylpropan-2-amine?
The canonical SMILES for 1-imidazol-1-yl-1,3-diphenylpropan-2-amine is NC(Cc1ccccc1)C(c1ccccc1)n1ccnc1.
What is the InChIKey of 1-imidazol-1-yl-1,3-diphenylpropan-2-amine?
The InChIKey is FNZASKVUDGTAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3/c19-17(13-15-7-3-1-4-8-15)18(21-12-11-20-14-21)16-9-5-2-6-10-16/h1-12,14,17-18H,13,19H2.
What are the key properties of 1-imidazol-1-yl-1,3-diphenylpropan-2-amine?
1-imidazol-1-yl-1,3-diphenylpropan-2-amine has a molecular weight of 277.37 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazol-1-yl-1,3-diphenylpropan-2-amine is sourced from PubChem (CID 16782420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).